C25H32ClFN8O4 — CID 86659790
(1S,2S,3R,4R,5R)-3-[(2-chloro-5-fluoropyrimidin-4-yl)amino]-5-[2-[2-(4-methylpiperazin-1-yl)-5-nitrophenoxy]ethylamino]bicyclo[2.2.1]heptane-2-carboxamide (PubChem CID 86659790) has the molecular formula C25H32ClFN8O4 and a molecular weight of 563.03 g/mol. Its IUPAC name is (1S,2S,3R,4R,5R)-3-[(2-chloro-5-fluoropyrimidin-4-yl)amino]-5-[2-[2-(4-methylpiperazin-1-yl)-5-nitrophenoxy]ethylamino]bicyclo[2.2.1]heptane-2-carboxamide.
| Compound Name | (1S,2S,3R,4R,5R)-3-[(2-chloro-5-fluoropyrimidin-4-yl)amino]-5-[2-[2-(4-methylpiperazin-1-yl)-5-nitrophenoxy]ethylamino]bicyclo[2.2.1]heptane-2-carboxamide |
|---|---|
| PubChem CID | 86659790 |
| Molecular Formula | C25H32ClFN8O4 |
| Molecular Weight | 563.03 g/mol |
| Exact Mass | 562.22 |
| IUPAC Name | (1S,2S,3R,4R,5R)-3-[(2-chloro-5-fluoropyrimidin-4-yl)amino]-5-[2-[2-(4-methylpiperazin-1-yl)-5-nitrophenoxy]ethylamino]bicyclo[2.2.1]heptane-2-carboxamide |
| SMILES | CN1CCN(c2ccc([N+](=O)[O-])cc2OCCN[C@@H]2C[C@@H]3C[C@H]2[C@@H](Nc2nc(Cl)ncc2F)[C@H]3C(N)=O)CC1 |
| InChI | InChI=1S/C25H32ClFN8O4/c1-33-5-7-34(8-6-33)19-3-2-15(35(37)38)12-20(19)39-9-4-29-18-11-14-10-16(18)22(21(14)23(28)36)31-24-17(27)13-30-25(26)32-24/h2-3,12-14,16,18,21-22,29H,4-11H2,1H3,(H2,28,36)(H,30,31,32)/t14-,16+,18+,21-,22+/m0/s1 |
| InChIKey | IZGRPNMAJDIFOH-ZWMGUCMKSA-N |
| XLogP | 1.89 |
| TPSA | 151.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.03 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|