C23H23ClFN5O4S — CID 58531886
(1R,2S,3S,4S,5R)-3-[(2-chloro-5-fluoropyrimidin-4-yl)methyl]-5-[2-(6-nitro-2,3-dihydroindol-1-yl)-2-oxoethyl]sulfanylbicyclo[2.2.1]heptane-2-carboxamide (PubChem CID 58531886) has the molecular formula C23H23ClFN5O4S and a molecular weight of 519.99 g/mol. Its IUPAC name is (1R,2S,3S,4S,5R)-3-[(2-chloro-5-fluoropyrimidin-4-yl)methyl]-5-[2-(6-nitro-2,3-dihydroindol-1-yl)-2-oxoethyl]sulfanylbicyclo[2.2.1]heptane-2-carboxamide.
| Compound Name | (1R,2S,3S,4S,5R)-3-[(2-chloro-5-fluoropyrimidin-4-yl)methyl]-5-[2-(6-nitro-2,3-dihydroindol-1-yl)-2-oxoethyl]sulfanylbicyclo[2.2.1]heptane-2-carboxamide |
|---|---|
| PubChem CID | 58531886 |
| Molecular Formula | C23H23ClFN5O4S |
| Molecular Weight | 519.99 g/mol |
| Exact Mass | 519.11 |
| IUPAC Name | (1R,2S,3S,4S,5R)-3-[(2-chloro-5-fluoropyrimidin-4-yl)methyl]-5-[2-(6-nitro-2,3-dihydroindol-1-yl)-2-oxoethyl]sulfanylbicyclo[2.2.1]heptane-2-carboxamide |
| SMILES | NC(=O)[C@H]1[C@@H]2C[C@@H]([C@H]1Cc1nc(Cl)ncc1F)[C@H](SCC(=O)N1CCc3ccc([N+](=O)[O-])cc31)C2 |
| InChI | InChI=1S/C23H23ClFN5O4S/c24-23-27-9-16(25)17(28-23)8-15-14-5-12(21(15)22(26)32)6-19(14)35-10-20(31)29-4-3-11-1-2-13(30(33)34)7-18(11)29/h1-2,7,9,12,14-15,19,21H,3-6,8,10H2,(H2,26,32)/t12-,14+,15-,19-,21+/m1/s1 |
| InChIKey | NEDGMTFAKUSNBA-WULQFEBVSA-N |
| XLogP | 3.17 |
| TPSA | 132.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.99 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|