C23H26ClFN6O2S — CID 90359677
(1S,2S,3S,4S,5R)-5-[2-(7-amino-3,4-dihydro-1H-isoquinolin-2-yl)-2-oxoethyl]sulfanyl-3-[(2-chloro-5-fluoropyrimidin-4-yl)amino]bicyclo[2.2.1]heptane-2-carboxamide (PubChem CID 90359677) has the molecular formula C23H26ClFN6O2S and a molecular weight of 505.02 g/mol. Its IUPAC name is (1S,2S,3S,4S,5R)-5-[2-(7-amino-3,4-dihydro-1H-isoquinolin-2-yl)-2-oxoethyl]sulfanyl-3-[(2-chloro-5-fluoropyrimidin-4-yl)amino]bicyclo[2.2.1]heptane-2-carboxamide.
| Compound Name | (1S,2S,3S,4S,5R)-5-[2-(7-amino-3,4-dihydro-1H-isoquinolin-2-yl)-2-oxoethyl]sulfanyl-3-[(2-chloro-5-fluoropyrimidin-4-yl)amino]bicyclo[2.2.1]heptane-2-carboxamide |
|---|---|
| PubChem CID | 90359677 |
| Molecular Formula | C23H26ClFN6O2S |
| Molecular Weight | 505.02 g/mol |
| Exact Mass | 504.15 |
| IUPAC Name | (1S,2S,3S,4S,5R)-5-[2-(7-amino-3,4-dihydro-1H-isoquinolin-2-yl)-2-oxoethyl]sulfanyl-3-[(2-chloro-5-fluoropyrimidin-4-yl)amino]bicyclo[2.2.1]heptane-2-carboxamide |
| SMILES | NC(=O)[C@H]1[C@H]2C[C@@H]([C@H]1Nc1nc(Cl)ncc1F)[C@H](SCC(=O)N1CCc3ccc(N)cc3C1)C2 |
| InChI | InChI=1S/C23H26ClFN6O2S/c24-23-28-8-16(25)22(30-23)29-20-15-6-12(19(20)21(27)33)7-17(15)34-10-18(32)31-4-3-11-1-2-14(26)5-13(11)9-31/h1-2,5,8,12,15,17,19-20H,3-4,6-7,9-10,26H2,(H2,27,33)(H,28,29,30)/t12-,15+,17+,19-,20+/m0/s1 |
| InChIKey | LNZWDZNXLLSGAK-DXZHPIEPSA-N |
| XLogP | 2.46 |
| TPSA | 127.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.02 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|