C20H24ClFN6O2 — CID 89086635
(1S)-5-[2-(3-aminophenoxy)ethylamino]-3-[(2-chloro-5-fluoropyrimidin-4-yl)amino]bicyclo[2.2.1]heptane-2-carboxamide (PubChem CID 89086635) has the molecular formula C20H24ClFN6O2 and a molecular weight of 434.90 g/mol. Its IUPAC name is (1S)-5-[2-(3-aminophenoxy)ethylamino]-3-[(2-chloro-5-fluoropyrimidin-4-yl)amino]bicyclo[2.2.1]heptane-2-carboxamide.
| Compound Name | (1S)-5-[2-(3-aminophenoxy)ethylamino]-3-[(2-chloro-5-fluoropyrimidin-4-yl)amino]bicyclo[2.2.1]heptane-2-carboxamide |
|---|---|
| PubChem CID | 89086635 |
| Molecular Formula | C20H24ClFN6O2 |
| Molecular Weight | 434.90 g/mol |
| Exact Mass | 434.16 |
| IUPAC Name | (1S)-5-[2-(3-aminophenoxy)ethylamino]-3-[(2-chloro-5-fluoropyrimidin-4-yl)amino]bicyclo[2.2.1]heptane-2-carboxamide |
| SMILES | NC(=O)C1C(Nc2nc(Cl)ncc2F)C2C[C@H]1CC2NCCOc1cccc(N)c1 |
| InChI | InChI=1S/C20H24ClFN6O2/c21-20-26-9-14(22)19(28-20)27-17-13-6-10(16(17)18(24)29)7-15(13)25-4-5-30-12-3-1-2-11(23)8-12/h1-3,8-10,13,15-17,25H,4-7,23H2,(H2,24,29)(H,26,27,28)/t10-,13?,15?,16?,17?/m0/s1 |
| InChIKey | ZVWJXCSNMSRTQO-JANPNXFJSA-N |
| XLogP | 1.81 |
| TPSA | 128.18 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.90 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|