C19H20ClFN6O4S — CID 89086738
(1R,2S,3R,4R,5R)-3-[(2-chloro-5-fluoropyrimidin-4-yl)amino]-5-[[(3-nitrosophenyl)sulfonylamino]methyl]bicyclo[2.2.1]heptane-2-carboxamide (PubChem CID 89086738) has the molecular formula C19H20ClFN6O4S and a molecular weight of 482.93 g/mol. Its IUPAC name is (1R,2S,3R,4R,5R)-3-[(2-chloro-5-fluoropyrimidin-4-yl)amino]-5-[[(3-nitrosophenyl)sulfonylamino]methyl]bicyclo[2.2.1]heptane-2-carboxamide.
| Compound Name | (1R,2S,3R,4R,5R)-3-[(2-chloro-5-fluoropyrimidin-4-yl)amino]-5-[[(3-nitrosophenyl)sulfonylamino]methyl]bicyclo[2.2.1]heptane-2-carboxamide |
|---|---|
| PubChem CID | 89086738 |
| Molecular Formula | C19H20ClFN6O4S |
| Molecular Weight | 482.93 g/mol |
| Exact Mass | 482.09 |
| IUPAC Name | (1R,2S,3R,4R,5R)-3-[(2-chloro-5-fluoropyrimidin-4-yl)amino]-5-[[(3-nitrosophenyl)sulfonylamino]methyl]bicyclo[2.2.1]heptane-2-carboxamide |
| SMILES | NC(=O)[C@H]1[C@@H]2C[C@@H](CNS(=O)(=O)c3cccc(N=O)c3)[C@@H](C2)[C@H]1Nc1nc(Cl)ncc1F |
| InChI | InChI=1S/C19H20ClFN6O4S/c20-19-23-8-14(21)18(26-19)25-16-13-5-9(15(16)17(22)28)4-10(13)7-24-32(30,31)12-3-1-2-11(6-12)27-29/h1-3,6,8-10,13,15-16,24H,4-5,7H2,(H2,22,28)(H,23,25,26)/t9-,10+,13-,15+,16-/m1/s1 |
| InChIKey | RFOSKZTZIDPZCQ-NEGUBRTISA-N |
| XLogP | 2.18 |
| TPSA | 156.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.93 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |