C21H25ClFN7O4 — CID 141257685
3-[(2-chloro-5-fluoropyrimidin-4-yl)amino]-5-[[[2-hydroxy-2-(3-nitroanilino)ethyl]amino]methyl]bicyclo[2.2.1]heptane-2-carboxamide (PubChem CID 141257685) has the molecular formula C21H25ClFN7O4 and a molecular weight of 493.93 g/mol. Its IUPAC name is 3-[(2-chloro-5-fluoropyrimidin-4-yl)amino]-5-[[[2-hydroxy-2-(3-nitroanilino)ethyl]amino]methyl]bicyclo[2.2.1]heptane-2-carboxamide.
| Compound Name | 3-[(2-chloro-5-fluoropyrimidin-4-yl)amino]-5-[[[2-hydroxy-2-(3-nitroanilino)ethyl]amino]methyl]bicyclo[2.2.1]heptane-2-carboxamide |
|---|---|
| PubChem CID | 141257685 |
| Molecular Formula | C21H25ClFN7O4 |
| Molecular Weight | 493.93 g/mol |
| Exact Mass | 493.16 |
| IUPAC Name | 3-[(2-chloro-5-fluoropyrimidin-4-yl)amino]-5-[[[2-hydroxy-2-(3-nitroanilino)ethyl]amino]methyl]bicyclo[2.2.1]heptane-2-carboxamide |
| SMILES | NC(=O)C1C2CC(CNCC(O)Nc3cccc([N+](=O)[O-])c3)C(C2)C1Nc1nc(Cl)ncc1F |
| InChI | InChI=1S/C21H25ClFN7O4/c22-21-26-8-15(23)20(29-21)28-18-14-5-10(17(18)19(24)32)4-11(14)7-25-9-16(31)27-12-2-1-3-13(6-12)30(33)34/h1-3,6,8,10-11,14,16-18,25,27,31H,4-5,7,9H2,(H2,24,32)(H,26,28,29) |
| InChIKey | OYBSDWLJRUBZDZ-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 168.33 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.93 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|