C22H30ClFN6O — CID 91548168
3-[(2-chloro-5-fluoropyrimidin-4-yl)amino]-5-[[[(2E,6Z)-5-imino-3-methylocta-2,6-dienyl]amino]methyl]bicyclo[2.2.1]heptane-2-carboxamide (PubChem CID 91548168) has the molecular formula C22H30ClFN6O and a molecular weight of 448.97 g/mol. Its IUPAC name is 3-[(2-chloro-5-fluoropyrimidin-4-yl)amino]-5-[[[(2E,6Z)-5-imino-3-methylocta-2,6-dienyl]amino]methyl]bicyclo[2.2.1]heptane-2-carboxamide.
| Compound Name | 3-[(2-chloro-5-fluoropyrimidin-4-yl)amino]-5-[[[(2E,6Z)-5-imino-3-methylocta-2,6-dienyl]amino]methyl]bicyclo[2.2.1]heptane-2-carboxamide |
|---|---|
| PubChem CID | 91548168 |
| Molecular Formula | C22H30ClFN6O |
| Molecular Weight | 448.97 g/mol |
| Exact Mass | 448.22 |
| IUPAC Name | 3-[(2-chloro-5-fluoropyrimidin-4-yl)amino]-5-[[[(2E,6Z)-5-imino-3-methylocta-2,6-dienyl]amino]methyl]bicyclo[2.2.1]heptane-2-carboxamide |
| SMILES | [H]/N=C(\C=C/C)C/C(C)=C/CNCC1CC2CC1C(Nc1nc(Cl)ncc1F)C2C(N)=O |
| InChI | InChI=1S/C22H30ClFN6O/c1-3-4-15(25)7-12(2)5-6-27-10-14-8-13-9-16(14)19(18(13)20(26)31)29-21-17(24)11-28-22(23)30-21/h3-5,11,13-14,16,18-19,25,27H,6-10H2,1-2H3,(H2,26,31)(H,28,29,30)/b4-3-,12-5+,25-15+ |
| InChIKey | WHYKGGDSHCYXIQ-WUJUZMCSSA-N |
| XLogP | 3.33 |
| TPSA | 116.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.97 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|