C18H20ClFN8O4 — CID 90348506
(1R,2S,3R,4R,5R)-3-[(2-chloro-5-fluoropyrimidin-4-yl)amino]-5-[[[2-(4-nitroimidazol-1-yl)acetyl]amino]methyl]bicyclo[2.2.1]heptane-2-carboxamide (PubChem CID 90348506) has the molecular formula C18H20ClFN8O4 and a molecular weight of 466.86 g/mol. Its IUPAC name is (1R,2S,3R,4R,5R)-3-[(2-chloro-5-fluoropyrimidin-4-yl)amino]-5-[[[2-(4-nitroimidazol-1-yl)acetyl]amino]methyl]bicyclo[2.2.1]heptane-2-carboxamide.
| Compound Name | (1R,2S,3R,4R,5R)-3-[(2-chloro-5-fluoropyrimidin-4-yl)amino]-5-[[[2-(4-nitroimidazol-1-yl)acetyl]amino]methyl]bicyclo[2.2.1]heptane-2-carboxamide |
|---|---|
| PubChem CID | 90348506 |
| Molecular Formula | C18H20ClFN8O4 |
| Molecular Weight | 466.86 g/mol |
| Exact Mass | 466.13 |
| IUPAC Name | (1R,2S,3R,4R,5R)-3-[(2-chloro-5-fluoropyrimidin-4-yl)amino]-5-[[[2-(4-nitroimidazol-1-yl)acetyl]amino]methyl]bicyclo[2.2.1]heptane-2-carboxamide |
| SMILES | NC(=O)[C@H]1[C@@H]2C[C@@H](CNC(=O)Cn3cnc([N+](=O)[O-])c3)[C@@H](C2)[C@H]1Nc1nc(Cl)ncc1F |
| InChI | InChI=1S/C18H20ClFN8O4/c19-18-23-4-11(20)17(26-18)25-15-10-2-8(14(15)16(21)30)1-9(10)3-22-13(29)6-27-5-12(24-7-27)28(31)32/h4-5,7-10,14-15H,1-3,6H2,(H2,21,30)(H,22,29)(H,23,25,26)/t8-,9+,10-,14+,15-/m1/s1 |
| InChIKey | BFLXODDHUQDFSM-WSOUCCKQSA-N |
| XLogP | 0.73 |
| TPSA | 170.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.86 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|