C22H25ClFN5O3S — CID 90348491
(1S,2S,3S,4S,5R)-5-[2-(3-acetamidophenoxy)ethylsulfanyl]-3-[(2-chloro-5-fluoropyrimidin-4-yl)amino]bicyclo[2.2.1]heptane-2-carboxamide (PubChem CID 90348491) has the molecular formula C22H25ClFN5O3S and a molecular weight of 493.99 g/mol. Its IUPAC name is (1S,2S,3S,4S,5R)-5-[2-(3-acetamidophenoxy)ethylsulfanyl]-3-[(2-chloro-5-fluoropyrimidin-4-yl)amino]bicyclo[2.2.1]heptane-2-carboxamide.
| Compound Name | (1S,2S,3S,4S,5R)-5-[2-(3-acetamidophenoxy)ethylsulfanyl]-3-[(2-chloro-5-fluoropyrimidin-4-yl)amino]bicyclo[2.2.1]heptane-2-carboxamide |
|---|---|
| PubChem CID | 90348491 |
| Molecular Formula | C22H25ClFN5O3S |
| Molecular Weight | 493.99 g/mol |
| Exact Mass | 493.14 |
| IUPAC Name | (1S,2S,3S,4S,5R)-5-[2-(3-acetamidophenoxy)ethylsulfanyl]-3-[(2-chloro-5-fluoropyrimidin-4-yl)amino]bicyclo[2.2.1]heptane-2-carboxamide |
| SMILES | CC(=O)Nc1cccc(OCCS[C@@H]2C[C@@H]3C[C@H]2[C@@H](Nc2nc(Cl)ncc2F)[C@H]3C(N)=O)c1 |
| InChI | InChI=1S/C22H25ClFN5O3S/c1-11(30)27-13-3-2-4-14(9-13)32-5-6-33-17-8-12-7-15(17)19(18(12)20(25)31)28-21-16(24)10-26-22(23)29-21/h2-4,9-10,12,15,17-19H,5-8H2,1H3,(H2,25,31)(H,27,30)(H,26,28,29)/t12-,15+,17+,18-,19+/m0/s1 |
| InChIKey | JWEXULARLDHIGO-KSOYODCDSA-N |
| XLogP | 3.33 |
| TPSA | 119.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.99 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|