C21H26ClFN6O — CID 89086736
(1R,2S,3R,4R,5R)-5-[[2-(3-aminophenyl)ethylamino]methyl]-3-[(2-chloro-5-fluoropyrimidin-4-yl)amino]bicyclo[2.2.1]heptane-2-carboxamide (PubChem CID 89086736) has the molecular formula C21H26ClFN6O and a molecular weight of 432.93 g/mol. Its IUPAC name is (1R,2S,3R,4R,5R)-5-[[2-(3-aminophenyl)ethylamino]methyl]-3-[(2-chloro-5-fluoropyrimidin-4-yl)amino]bicyclo[2.2.1]heptane-2-carboxamide.
| Compound Name | (1R,2S,3R,4R,5R)-5-[[2-(3-aminophenyl)ethylamino]methyl]-3-[(2-chloro-5-fluoropyrimidin-4-yl)amino]bicyclo[2.2.1]heptane-2-carboxamide |
|---|---|
| PubChem CID | 89086736 |
| Molecular Formula | C21H26ClFN6O |
| Molecular Weight | 432.93 g/mol |
| Exact Mass | 432.18 |
| IUPAC Name | (1R,2S,3R,4R,5R)-5-[[2-(3-aminophenyl)ethylamino]methyl]-3-[(2-chloro-5-fluoropyrimidin-4-yl)amino]bicyclo[2.2.1]heptane-2-carboxamide |
| SMILES | NC(=O)[C@H]1[C@@H]2C[C@@H](CNCCc3cccc(N)c3)[C@@H](C2)[C@H]1Nc1nc(Cl)ncc1F |
| InChI | InChI=1S/C21H26ClFN6O/c22-21-27-10-16(23)20(29-21)28-18-15-8-12(17(18)19(25)30)7-13(15)9-26-5-4-11-2-1-3-14(24)6-11/h1-3,6,10,12-13,15,17-18,26H,4-5,7-9,24H2,(H2,25,30)(H,27,28,29)/t12-,13+,15-,17+,18-/m1/s1 |
| InChIKey | HGAOYXDDBZGPSM-IPUKNANDSA-N |
| XLogP | 2.22 |
| TPSA | 118.95 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.93 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|