C25H32ClFN8O3 — CID 58531998
[5-amino-2-(4-methylpiperazin-1-yl)phenyl]methyl N-[(1R,2R,4R,5S,6R)-5-carbamoyl-6-[(2-chloro-5-fluoropyrimidin-4-yl)amino]-2-bicyclo[2.2.1]heptanyl]carbamate (PubChem CID 58531998) has the molecular formula C25H32ClFN8O3 and a molecular weight of 547.04 g/mol. Its IUPAC name is [5-amino-2-(4-methylpiperazin-1-yl)phenyl]methyl N-[(1R,2R,4R,5S,6R)-5-carbamoyl-6-[(2-chloro-5-fluoropyrimidin-4-yl)amino]-2-bicyclo[2.2.1]heptanyl]carbamate.
| Compound Name | [5-amino-2-(4-methylpiperazin-1-yl)phenyl]methyl N-[(1R,2R,4R,5S,6R)-5-carbamoyl-6-[(2-chloro-5-fluoropyrimidin-4-yl)amino]-2-bicyclo[2.2.1]heptanyl]carbamate |
|---|---|
| PubChem CID | 58531998 |
| Molecular Formula | C25H32ClFN8O3 |
| Molecular Weight | 547.04 g/mol |
| Exact Mass | 546.23 |
| IUPAC Name | [5-amino-2-(4-methylpiperazin-1-yl)phenyl]methyl N-[(1R,2R,4R,5S,6R)-5-carbamoyl-6-[(2-chloro-5-fluoropyrimidin-4-yl)amino]-2-bicyclo[2.2.1]heptanyl]carbamate |
| SMILES | CN1CCN(c2ccc(N)cc2COC(=O)N[C@@H]2C[C@H]3C[C@H]2[C@@H](Nc2nc(Cl)ncc2F)[C@H]3C(N)=O)CC1 |
| InChI | InChI=1S/C25H32ClFN8O3/c1-34-4-6-35(7-5-34)19-3-2-15(28)8-14(19)12-38-25(37)31-18-10-13-9-16(18)21(20(13)22(29)36)32-23-17(27)11-30-24(26)33-23/h2-3,8,11,13,16,18,20-21H,4-7,9-10,12,28H2,1H3,(H2,29,36)(H,31,37)(H,30,32,33)/t13-,16-,18-,20+,21-/m1/s1 |
| InChIKey | LKBJOOVIFRTNQF-FUVWPONJSA-N |
| XLogP | 1.82 |
| TPSA | 151.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.04 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|