C24H21FO6S2 — CID 86660711
[(2S)-1,1-bis(benzenesulfonyl)-1-fluoro-4-phenylbut-3-en-2-yl] acetate (PubChem CID 86660711) has the molecular formula C24H21FO6S2 and a molecular weight of 488.56 g/mol. Its IUPAC name is [(2S)-1,1-bis(benzenesulfonyl)-1-fluoro-4-phenylbut-3-en-2-yl] acetate.
| Compound Name | [(2S)-1,1-bis(benzenesulfonyl)-1-fluoro-4-phenylbut-3-en-2-yl] acetate |
|---|---|
| PubChem CID | 86660711 |
| Molecular Formula | C24H21FO6S2 |
| Molecular Weight | 488.56 g/mol |
| Exact Mass | 488.08 |
| IUPAC Name | [(2S)-1,1-bis(benzenesulfonyl)-1-fluoro-4-phenylbut-3-en-2-yl] acetate |
| SMILES | CC(=O)O[C@@H](C=Cc1ccccc1)C(F)(S(=O)(=O)c1ccccc1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C24H21FO6S2/c1-19(26)31-23(18-17-20-11-5-2-6-12-20)24(25,32(27,28)21-13-7-3-8-14-21)33(29,30)22-15-9-4-10-16-22/h2-18,23H,1H3/t23-/m0/s1 |
| InChIKey | JHWVDFAQDYTALT-QHCPKHFHSA-N |
| XLogP | 4.20 |
| TPSA | 94.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.56 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |