C10H12ClIN4O — CID 86705347
1-[(6-chloro-3-iodoimidazo[1,2-b]pyridazin-8-yl)amino]-2-methylpropan-2-ol (PubChem CID 86705347) has the molecular formula C10H12ClIN4O and a molecular weight of 366.59 g/mol. Its IUPAC name is 1-[(6-chloro-3-iodoimidazo[1,2-b]pyridazin-8-yl)amino]-2-methylpropan-2-ol.
| Compound Name | 1-[(6-chloro-3-iodoimidazo[1,2-b]pyridazin-8-yl)amino]-2-methylpropan-2-ol |
|---|---|
| PubChem CID | 86705347 |
| Molecular Formula | C10H12ClIN4O |
| Molecular Weight | 366.59 g/mol |
| Exact Mass | 365.97 |
| IUPAC Name | 1-[(6-chloro-3-iodoimidazo[1,2-b]pyridazin-8-yl)amino]-2-methylpropan-2-ol |
| SMILES | CC(C)(O)CNc1cc(Cl)nn2c(I)cnc12 |
| InChI | InChI=1S/C10H12ClIN4O/c1-10(2,17)5-14-6-3-7(11)15-16-8(12)4-13-9(6)16/h3-4,14,17H,5H2,1-2H3 |
| InChIKey | OJUAZAZYZJBJBT-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 62.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.59 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|