C30H34FN7O6 — CID 86709975
[2-[4-[[1-(2-fluoroethyl)azetidin-3-yl]amino]-2-methoxyanilino]-4-(3-nitrophenoxy)pyrrolo[2,3-d]pyrimidin-7-yl]methyl 2,2-dimethylpropanoate (PubChem CID 86709975) has the molecular formula C30H34FN7O6 and a molecular weight of 607.64 g/mol. Its IUPAC name is [2-[4-[[1-(2-fluoroethyl)azetidin-3-yl]amino]-2-methoxyanilino]-4-(3-nitrophenoxy)pyrrolo[2,3-d]pyrimidin-7-yl]methyl 2,2-dimethylpropanoate.
| Compound Name | [2-[4-[[1-(2-fluoroethyl)azetidin-3-yl]amino]-2-methoxyanilino]-4-(3-nitrophenoxy)pyrrolo[2,3-d]pyrimidin-7-yl]methyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 86709975 |
| Molecular Formula | C30H34FN7O6 |
| Molecular Weight | 607.64 g/mol |
| Exact Mass | 607.26 |
| IUPAC Name | [2-[4-[[1-(2-fluoroethyl)azetidin-3-yl]amino]-2-methoxyanilino]-4-(3-nitrophenoxy)pyrrolo[2,3-d]pyrimidin-7-yl]methyl 2,2-dimethylpropanoate |
| SMILES | COc1cc(NC2CN(CCF)C2)ccc1Nc1nc(Oc2cccc([N+](=O)[O-])c2)c2ccn(COC(=O)C(C)(C)C)c2n1 |
| InChI | InChI=1S/C30H34FN7O6/c1-30(2,3)28(39)43-18-37-12-10-23-26(37)34-29(35-27(23)44-22-7-5-6-21(15-22)38(40)41)33-24-9-8-19(14-25(24)42-4)32-20-16-36(17-20)13-11-31/h5-10,12,14-15,20,32H,11,13,16-18H2,1-4H3,(H,33,34,35) |
| InChIKey | XGXIIXAFFBIPRT-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 145.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.64 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|