C35H38F2O8S2 — CID 86712465
1,1-difluoro-2-(2-methylprop-2-enoyloxy)ethanesulfonate;(1-ethylcyclopentyl) 2-(4-dibenzothiophen-5-ium-5-yl-2,6-dimethylphenoxy)acetate (PubChem CID 86712465) has the molecular formula C35H38F2O8S2 and a molecular weight of 688.81 g/mol. Its IUPAC name is 1,1-difluoro-2-(2-methylprop-2-enoyloxy)ethanesulfonate;(1-ethylcyclopentyl) 2-(4-dibenzothiophen-5-ium-5-yl-2,6-dimethylphenoxy)acetate.
| Compound Name | 1,1-difluoro-2-(2-methylprop-2-enoyloxy)ethanesulfonate;(1-ethylcyclopentyl) 2-(4-dibenzothiophen-5-ium-5-yl-2,6-dimethylphenoxy)acetate |
|---|---|
| PubChem CID | 86712465 |
| Molecular Formula | C35H38F2O8S2 |
| Molecular Weight | 688.81 g/mol |
| Exact Mass | 688.20 |
| IUPAC Name | 1,1-difluoro-2-(2-methylprop-2-enoyloxy)ethanesulfonate;(1-ethylcyclopentyl) 2-(4-dibenzothiophen-5-ium-5-yl-2,6-dimethylphenoxy)acetate |
| SMILES | C=C(C)C(=O)OCC(F)(F)S(=O)(=O)[O-].CCC1(OC(=O)COc2c(C)cc(-[s+]3c4ccccc4c4ccccc43)cc2C)CCCC1 |
| InChI | InChI=1S/C29H31O3S.C6H8F2O5S/c1-4-29(15-9-10-16-29)32-27(30)19-31-28-20(2)17-22(18-21(28)3)33-25-13-7-5-11-23(25)24-12-6-8-14-26(24)33;1-4(2)5(9)13-3-6(7,8)14(10,11)12/h5-8,11-14,17-18H,4,9-10,15-16,19H2,1-3H3;1,3H2,2H3,(H,10,11,12)/q+1;/p-1 |
| InChIKey | CWIQIWPSCBKHTO-UHFFFAOYSA-M |
| XLogP | 8.24 |
| TPSA | 119.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 688.81 |
| LogP ≤ 5 | 8.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|