C31H34F2O8S2 — CID 131747241
1,1-difluoro-2-(2-methylprop-2-enoyloxy)ethanesulfonate;5-[4-[2-(2-methoxyethoxy)ethoxy]-3,5-dimethylphenyl]dibenzothiophen-5-ium (PubChem CID 131747241) has the molecular formula C31H34F2O8S2 and a molecular weight of 636.73 g/mol. Its IUPAC name is 1,1-difluoro-2-(2-methylprop-2-enoyloxy)ethanesulfonate;5-[4-[2-(2-methoxyethoxy)ethoxy]-3,5-dimethylphenyl]dibenzothiophen-5-ium.
| Compound Name | 1,1-difluoro-2-(2-methylprop-2-enoyloxy)ethanesulfonate;5-[4-[2-(2-methoxyethoxy)ethoxy]-3,5-dimethylphenyl]dibenzothiophen-5-ium |
|---|---|
| PubChem CID | 131747241 |
| Molecular Formula | C31H34F2O8S2 |
| Molecular Weight | 636.73 g/mol |
| Exact Mass | 636.17 |
| IUPAC Name | 1,1-difluoro-2-(2-methylprop-2-enoyloxy)ethanesulfonate;5-[4-[2-(2-methoxyethoxy)ethoxy]-3,5-dimethylphenyl]dibenzothiophen-5-ium |
| SMILES | C=C(C)C(=O)OCC(F)(F)S(=O)(=O)[O-].COCCOCCOc1c(C)cc(-[s+]2c3ccccc3c3ccccc32)cc1C |
| InChI | InChI=1S/C25H27O3S.C6H8F2O5S/c1-18-16-20(17-19(2)25(18)28-15-14-27-13-12-26-3)29-23-10-6-4-8-21(23)22-9-5-7-11-24(22)29;1-4(2)5(9)13-3-6(7,8)14(10,11)12/h4-11,16-17H,12-15H2,1-3H3;1,3H2,2H3,(H,10,11,12)/q+1;/p-1 |
| InChIKey | FJZLRBBFBOPDDL-UHFFFAOYSA-M |
| XLogP | 6.63 |
| TPSA | 111.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.73 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|