C19H30N2O4 — CID 86715021
tert-butyl 2-[(3S,5E,12S)-2,9-dioxo-1,10-diazabicyclo[10.3.0]pentadec-5-en-3-yl]acetate (PubChem CID 86715021) has the molecular formula C19H30N2O4 and a molecular weight of 350.46 g/mol. Its IUPAC name is tert-butyl 2-[(3S,5E,12S)-2,9-dioxo-1,10-diazabicyclo[10.3.0]pentadec-5-en-3-yl]acetate.
| Compound Name | tert-butyl 2-[(3S,5E,12S)-2,9-dioxo-1,10-diazabicyclo[10.3.0]pentadec-5-en-3-yl]acetate |
|---|---|
| PubChem CID | 86715021 |
| Molecular Formula | C19H30N2O4 |
| Molecular Weight | 350.46 g/mol |
| Exact Mass | 350.22 |
| IUPAC Name | tert-butyl 2-[(3S,5E,12S)-2,9-dioxo-1,10-diazabicyclo[10.3.0]pentadec-5-en-3-yl]acetate |
| SMILES | CC(C)(C)OC(=O)C[C@@H]1C/C=C/CCC(=O)NC[C@@H]2CCCN2C1=O |
| InChI | InChI=1S/C19H30N2O4/c1-19(2,3)25-17(23)12-14-8-5-4-6-10-16(22)20-13-15-9-7-11-21(15)18(14)24/h4-5,14-15H,6-13H2,1-3H3,(H,20,22)/b5-4+/t14-,15-/m0/s1 |
| InChIKey | VGJYNJICERRGIT-WFVIONGDSA-N |
| XLogP | 2.18 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.46 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|