C19H23Cl2N2+ — CID 86719651
1-butyl-4,5-dichloro-3-(2-ethyl-1H-naphthalen-2-yl)imidazol-1-ium (PubChem CID 86719651) has the molecular formula C19H23Cl2N2+ and a molecular weight of 350.31 g/mol. Its IUPAC name is 1-butyl-4,5-dichloro-3-(2-ethyl-1H-naphthalen-2-yl)imidazol-1-ium.
| Compound Name | 1-butyl-4,5-dichloro-3-(2-ethyl-1H-naphthalen-2-yl)imidazol-1-ium |
|---|---|
| PubChem CID | 86719651 |
| Molecular Formula | C19H23Cl2N2+ |
| Molecular Weight | 350.31 g/mol |
| Exact Mass | 349.12 |
| IUPAC Name | 1-butyl-4,5-dichloro-3-(2-ethyl-1H-naphthalen-2-yl)imidazol-1-ium |
| SMILES | CCCC[n+]1cn(C2(CC)C=Cc3ccccc3C2)c(Cl)c1Cl |
| InChI | InChI=1S/C19H23Cl2N2/c1-3-5-12-22-14-23(18(21)17(22)20)19(4-2)11-10-15-8-6-7-9-16(15)13-19/h6-11,14H,3-5,12-13H2,1-2H3/q+1 |
| InChIKey | KUXFBPNSXNABIM-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 8.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.31 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|