C25H35Cl2N2+ — CID 86719663
4,5-dichloro-1-decyl-3-(2-ethyl-1H-naphthalen-2-yl)imidazol-1-ium (PubChem CID 86719663) has the molecular formula C25H35Cl2N2+ and a molecular weight of 434.48 g/mol. Its IUPAC name is 4,5-dichloro-1-decyl-3-(2-ethyl-1H-naphthalen-2-yl)imidazol-1-ium.
| Compound Name | 4,5-dichloro-1-decyl-3-(2-ethyl-1H-naphthalen-2-yl)imidazol-1-ium |
|---|---|
| PubChem CID | 86719663 |
| Molecular Formula | C25H35Cl2N2+ |
| Molecular Weight | 434.48 g/mol |
| Exact Mass | 433.22 |
| IUPAC Name | 4,5-dichloro-1-decyl-3-(2-ethyl-1H-naphthalen-2-yl)imidazol-1-ium |
| SMILES | CCCCCCCCCC[n+]1cn(C2(CC)C=Cc3ccccc3C2)c(Cl)c1Cl |
| InChI | InChI=1S/C25H35Cl2N2/c1-3-5-6-7-8-9-10-13-18-28-20-29(24(27)23(28)26)25(4-2)17-16-21-14-11-12-15-22(21)19-25/h11-12,14-17,20H,3-10,13,18-19H2,1-2H3/q+1 |
| InChIKey | WNVAIEONYQCWDR-UHFFFAOYSA-N |
| XLogP | 7.60 |
| TPSA | 8.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.48 |
| LogP ≤ 5 | 7.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|