C24H31Cl2N2+ — CID 89158108
4,5-dichloro-1-decyl-3-(2-methylnaphthalen-1-yl)imidazol-1-ium (PubChem CID 89158108) has the molecular formula C24H31Cl2N2+ and a molecular weight of 418.43 g/mol. Its IUPAC name is 4,5-dichloro-1-decyl-3-(2-methylnaphthalen-1-yl)imidazol-1-ium.
| Compound Name | 4,5-dichloro-1-decyl-3-(2-methylnaphthalen-1-yl)imidazol-1-ium |
|---|---|
| PubChem CID | 89158108 |
| Molecular Formula | C24H31Cl2N2+ |
| Molecular Weight | 418.43 g/mol |
| Exact Mass | 417.19 |
| IUPAC Name | 4,5-dichloro-1-decyl-3-(2-methylnaphthalen-1-yl)imidazol-1-ium |
| SMILES | CCCCCCCCCC[n+]1cn(-c2c(C)ccc3ccccc23)c(Cl)c1Cl |
| InChI | InChI=1S/C24H31Cl2N2/c1-3-4-5-6-7-8-9-12-17-27-18-28(24(26)23(27)25)22-19(2)15-16-20-13-10-11-14-21(20)22/h10-11,13-16,18H,3-9,12,17H2,1-2H3/q+1 |
| InChIKey | VYLQRQSSGWCINY-UHFFFAOYSA-N |
| XLogP | 7.67 |
| TPSA | 8.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.43 |
| LogP ≤ 5 | 7.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|