C20H25BrCl2N2 — CID 86719652
4,5-dichloro-1-(2-ethyl-1H-naphthalen-2-yl)-3-pentylimidazol-3-ium bromide (PubChem CID 86719652) has the molecular formula C20H25BrCl2N2 and a molecular weight of 444.24 g/mol. Its IUPAC name is 4,5-dichloro-1-(2-ethyl-1H-naphthalen-2-yl)-3-pentylimidazol-3-ium bromide.
| Compound Name | 4,5-dichloro-1-(2-ethyl-1H-naphthalen-2-yl)-3-pentylimidazol-3-ium bromide |
|---|---|
| PubChem CID | 86719652 |
| Molecular Formula | C20H25BrCl2N2 |
| Molecular Weight | 444.24 g/mol |
| Exact Mass | 442.06 |
| IUPAC Name | 4,5-dichloro-1-(2-ethyl-1H-naphthalen-2-yl)-3-pentylimidazol-3-ium bromide |
| SMILES | CCCCC[n+]1cn(C2(CC)C=Cc3ccccc3C2)c(Cl)c1Cl.[Br-] |
| InChI | InChI=1S/C20H25Cl2N2.BrH/c1-3-5-8-13-23-15-24(19(22)18(23)21)20(4-2)12-11-16-9-6-7-10-17(16)14-20;/h6-7,9-12,15H,3-5,8,13-14H2,1-2H3;1H/q+1;/p-1 |
| InChIKey | UZCSISHGDXQLEF-UHFFFAOYSA-M |
| XLogP | 2.65 |
| TPSA | 8.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.24 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|