C13H17F2NOS — CID 86732255
(R)-N-[2-fluoro-1-(2-fluoro-3-methylphenyl)ethylidene]-2-methylpropane-2-sulfinamide (PubChem CID 86732255) has the molecular formula C13H17F2NOS and a molecular weight of 273.35 g/mol. Its IUPAC name is (R)-N-[2-fluoro-1-(2-fluoro-3-methylphenyl)ethylidene]-2-methylpropane-2-sulfinamide.
| Compound Name | (R)-N-[2-fluoro-1-(2-fluoro-3-methylphenyl)ethylidene]-2-methylpropane-2-sulfinamide |
|---|---|
| PubChem CID | 86732255 |
| Molecular Formula | C13H17F2NOS |
| Molecular Weight | 273.35 g/mol |
| Exact Mass | 273.10 |
| IUPAC Name | (R)-N-[2-fluoro-1-(2-fluoro-3-methylphenyl)ethylidene]-2-methylpropane-2-sulfinamide |
| SMILES | Cc1cccc(C(CF)=N[S@](=O)C(C)(C)C)c1F |
| InChI | InChI=1S/C13H17F2NOS/c1-9-6-5-7-10(12(9)15)11(8-14)16-18(17)13(2,3)4/h5-7H,8H2,1-4H3/t18-/m1/s1 |
| InChIKey | HUYAWOLCAAUFGH-GOSISDBHSA-N |
| XLogP | 3.35 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.35 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|