C10H9Cl2N3O2 — CID 86732607
2-diazo-2-(3,4-dichlorophenyl)-N-methoxy-N-methylacetamide (PubChem CID 86732607) has the molecular formula C10H9Cl2N3O2 and a molecular weight of 274.11 g/mol. Its IUPAC name is 2-diazo-2-(3,4-dichlorophenyl)-N-methoxy-N-methylacetamide.
| Compound Name | 2-diazo-2-(3,4-dichlorophenyl)-N-methoxy-N-methylacetamide |
|---|---|
| PubChem CID | 86732607 |
| Molecular Formula | C10H9Cl2N3O2 |
| Molecular Weight | 274.11 g/mol |
| Exact Mass | 273.01 |
| IUPAC Name | 2-diazo-2-(3,4-dichlorophenyl)-N-methoxy-N-methylacetamide |
| SMILES | CON(C)C(=O)C(=[N+]=[N-])c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C10H9Cl2N3O2/c1-15(17-2)10(16)9(14-13)6-3-4-7(11)8(12)5-6/h3-5H,1-2H3 |
| InChIKey | BLCUNSSQGSAAFU-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 65.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.11 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|