C13H24N2O3 — CID 86733858
2-(diethylamino)ethyl 2-methylprop-2-enoate;prop-2-enamide (PubChem CID 86733858) has the molecular formula C13H24N2O3 and a molecular weight of 256.35 g/mol. Its IUPAC name is 2-(diethylamino)ethyl 2-methylprop-2-enoate;prop-2-enamide.
| Compound Name | 2-(diethylamino)ethyl 2-methylprop-2-enoate;prop-2-enamide |
|---|---|
| PubChem CID | 86733858 |
| Molecular Formula | C13H24N2O3 |
| Molecular Weight | 256.35 g/mol |
| Exact Mass | 256.18 |
| IUPAC Name | 2-(diethylamino)ethyl 2-methylprop-2-enoate;prop-2-enamide |
| SMILES | C=C(C)C(=O)OCCN(CC)CC.C=CC(N)=O |
| InChI | InChI=1S/C10H19NO2.C3H5NO/c1-5-11(6-2)7-8-13-10(12)9(3)4;1-2-3(4)5/h3,5-8H2,1-2,4H3;2H,1H2,(H2,4,5) |
| InChIKey | VINCHKLLOIGLAR-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.35 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|