C10H16N4O2 — CID 86734455
3-heptanoyl-1H-1,2,4-triazole-5-carboxamide (PubChem CID 86734455) has the molecular formula C10H16N4O2 and a molecular weight of 224.26 g/mol. Its IUPAC name is 3-heptanoyl-1H-1,2,4-triazole-5-carboxamide.
| Compound Name | 3-heptanoyl-1H-1,2,4-triazole-5-carboxamide |
|---|---|
| PubChem CID | 86734455 |
| Molecular Formula | C10H16N4O2 |
| Molecular Weight | 224.26 g/mol |
| Exact Mass | 224.13 |
| IUPAC Name | 3-heptanoyl-1H-1,2,4-triazole-5-carboxamide |
| SMILES | CCCCCCC(=O)c1n[nH]c(C(N)=O)n1 |
| InChI | InChI=1S/C10H16N4O2/c1-2-3-4-5-6-7(15)9-12-10(8(11)16)14-13-9/h2-6H2,1H3,(H2,11,16)(H,12,13,14) |
| InChIKey | BLOYMAAYFKYEDF-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 101.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.26 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|