C14H12N2O4 — CID 86737528
ethyl 3-oxo-5H-pyrimido[2,1-c][1,4]benzoxazine-1-carboxylate (PubChem CID 86737528) has the molecular formula C14H12N2O4 and a molecular weight of 272.26 g/mol. Its IUPAC name is ethyl 3-oxo-5H-pyrimido[2,1-c][1,4]benzoxazine-1-carboxylate.
| Compound Name | ethyl 3-oxo-5H-pyrimido[2,1-c][1,4]benzoxazine-1-carboxylate |
|---|---|
| PubChem CID | 86737528 |
| Molecular Formula | C14H12N2O4 |
| Molecular Weight | 272.26 g/mol |
| Exact Mass | 272.08 |
| IUPAC Name | ethyl 3-oxo-5H-pyrimido[2,1-c][1,4]benzoxazine-1-carboxylate |
| SMILES | CCOC(=O)c1cc(=O)nc2n1-c1ccccc1OC2 |
| InChI | InChI=1S/C14H12N2O4/c1-2-19-14(18)10-7-13(17)15-12-8-20-11-6-4-3-5-9(11)16(10)12/h3-7H,2,8H2,1H3 |
| InChIKey | KIDNJLWRYVWFBP-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 70.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.26 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |