C26H36N4O6 — CID 86747819
(Z)-3-[2-butyl-3-[(4-methoxycarbonylphenyl)methyl]imidazol-4-yl]-2-[butyl(methoxymethylcarbamoyl)amino]prop-2-enoic acid (PubChem CID 86747819) has the molecular formula C26H36N4O6 and a molecular weight of 500.60 g/mol. Its IUPAC name is (Z)-3-[2-butyl-3-[(4-methoxycarbonylphenyl)methyl]imidazol-4-yl]-2-[butyl(methoxymethylcarbamoyl)amino]prop-2-enoic acid.
| Compound Name | (Z)-3-[2-butyl-3-[(4-methoxycarbonylphenyl)methyl]imidazol-4-yl]-2-[butyl(methoxymethylcarbamoyl)amino]prop-2-enoic acid |
|---|---|
| PubChem CID | 86747819 |
| Molecular Formula | C26H36N4O6 |
| Molecular Weight | 500.60 g/mol |
| Exact Mass | 500.26 |
| IUPAC Name | (Z)-3-[2-butyl-3-[(4-methoxycarbonylphenyl)methyl]imidazol-4-yl]-2-[butyl(methoxymethylcarbamoyl)amino]prop-2-enoic acid |
| SMILES | CCCCc1ncc(/C=C(/C(=O)O)N(CCCC)C(=O)NCOC)n1Cc1ccc(C(=O)OC)cc1 |
| InChI | InChI=1S/C26H36N4O6/c1-5-7-9-23-27-16-21(30(23)17-19-10-12-20(13-11-19)25(33)36-4)15-22(24(31)32)29(14-8-6-2)26(34)28-18-35-3/h10-13,15-16H,5-9,14,17-18H2,1-4H3,(H,28,34)(H,31,32)/b22-15- |
| InChIKey | KBTXNELVGSEWBW-JCMHNJIXSA-N |
| XLogP | 3.90 |
| TPSA | 122.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.60 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|