About (1a-propoxy-7H-oxireno[2,3-b]chromen-7a-yl) nitrate
(1a-propoxy-7H-oxireno[2,3-b]chromen-7a-yl) nitrate (PubChem CID 86748211) has the molecular formula C12H13NO6
and a molecular weight of 267.24 g/mol. Its IUPAC name is (1a-propoxy-7H-oxireno[2,3-b]chromen-7a-yl) nitrate.
Molecular Properties
| Compound Name | (1a-propoxy-7H-oxireno[2,3-b]chromen-7a-yl) nitrate |
| PubChem CID | 86748211 |
| Molecular Formula | C12H13NO6 |
| Molecular Weight | 267.24 g/mol |
| Exact Mass | 267.07 |
| IUPAC Name | (1a-propoxy-7H-oxireno[2,3-b]chromen-7a-yl) nitrate |
| SMILES | CCCOC12Oc3ccccc3CC1(O[N+](=O)[O-])O2 |
| InChI | InChI=1S/C12H13NO6/c1-2-7-16-12-11(18-12,19-13(14)15)8-9-5-3-4-6-10(9)17-12/h3-6H,2,7-8H2,1H3 |
| InChIKey | LWYHGBFNLXFVOS-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 83.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.24 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze (1a-propoxy-7H-oxireno[2,3-b]chromen-7a-yl) nitrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1a-propoxy-7H-oxireno[2,3-b]chromen-7a-yl) nitrate?
The IUPAC name of (1a-propoxy-7H-oxireno[2,3-b]chromen-7a-yl) nitrate (CID 86748211) is (1a-propoxy-7H-oxireno[2,3-b]chromen-7a-yl) nitrate.
What is the SMILES notation for (1a-propoxy-7H-oxireno[2,3-b]chromen-7a-yl) nitrate?
The canonical SMILES for (1a-propoxy-7H-oxireno[2,3-b]chromen-7a-yl) nitrate is CCCOC12Oc3ccccc3CC1(O[N+](=O)[O-])O2.
What is the InChIKey of (1a-propoxy-7H-oxireno[2,3-b]chromen-7a-yl) nitrate?
The InChIKey is LWYHGBFNLXFVOS-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13NO6/c1-2-7-16-12-11(18-12,19-13(14)15)8-9-5-3-4-6-10(9)17-12/h3-6H,2,7-8H2,1H3.
What are the key properties of (1a-propoxy-7H-oxireno[2,3-b]chromen-7a-yl) nitrate?
(1a-propoxy-7H-oxireno[2,3-b]chromen-7a-yl) nitrate has a molecular weight of 267.24 g/mol, XLogP of 1.64, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (1a-propoxy-7H-oxireno[2,3-b]chromen-7a-yl) nitrate is sourced from PubChem (CID 86748211), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).