C18H23N9O3 — CID 86763005
1-[4-(dimethylamino)phenyl]-3-[[1-[2-(2-methyl-5-nitroimidazol-1-yl)ethyl]triazol-4-yl]methyl]urea (PubChem CID 86763005) has the molecular formula C18H23N9O3 and a molecular weight of 413.44 g/mol. Its IUPAC name is 1-[4-(dimethylamino)phenyl]-3-[[1-[2-(2-methyl-5-nitroimidazol-1-yl)ethyl]triazol-4-yl]methyl]urea.
| Compound Name | 1-[4-(dimethylamino)phenyl]-3-[[1-[2-(2-methyl-5-nitroimidazol-1-yl)ethyl]triazol-4-yl]methyl]urea |
|---|---|
| PubChem CID | 86763005 |
| Molecular Formula | C18H23N9O3 |
| Molecular Weight | 413.44 g/mol |
| Exact Mass | 413.19 |
| IUPAC Name | 1-[4-(dimethylamino)phenyl]-3-[[1-[2-(2-methyl-5-nitroimidazol-1-yl)ethyl]triazol-4-yl]methyl]urea |
| SMILES | Cc1ncc([N+](=O)[O-])n1CCn1cc(CNC(=O)Nc2ccc(N(C)C)cc2)nn1 |
| InChI | InChI=1S/C18H23N9O3/c1-13-19-11-17(27(29)30)26(13)9-8-25-12-15(22-23-25)10-20-18(28)21-14-4-6-16(7-5-14)24(2)3/h4-7,11-12H,8-10H2,1-3H3,(H2,20,21,28) |
| InChIKey | VPUVKHKFJDWKPZ-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 136.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.44 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|