About pent-1-en-3-yl 4-carbamoylbenzoate
pent-1-en-3-yl 4-carbamoylbenzoate (PubChem CID 86782375) has the molecular formula C13H15NO3
and a molecular weight of 233.27 g/mol. Its IUPAC name is pent-1-en-3-yl 4-carbamoylbenzoate.
Molecular Properties
| Compound Name | pent-1-en-3-yl 4-carbamoylbenzoate |
| PubChem CID | 86782375 |
| Molecular Formula | C13H15NO3 |
| Molecular Weight | 233.27 g/mol |
| Exact Mass | 233.11 |
| IUPAC Name | pent-1-en-3-yl 4-carbamoylbenzoate |
| SMILES | C=CC(CC)OC(=O)c1ccc(C(N)=O)cc1 |
| InChI | InChI=1S/C13H15NO3/c1-3-11(4-2)17-13(16)10-7-5-9(6-8-10)12(14)15/h3,5-8,11H,1,4H2,2H3,(H2,14,15) |
| InChIKey | DFCWTOFALXQNBP-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.27 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze pent-1-en-3-yl 4-carbamoylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pent-1-en-3-yl 4-carbamoylbenzoate?
The IUPAC name of pent-1-en-3-yl 4-carbamoylbenzoate (CID 86782375) is pent-1-en-3-yl 4-carbamoylbenzoate.
What is the SMILES notation for pent-1-en-3-yl 4-carbamoylbenzoate?
The canonical SMILES for pent-1-en-3-yl 4-carbamoylbenzoate is C=CC(CC)OC(=O)c1ccc(C(N)=O)cc1.
What is the InChIKey of pent-1-en-3-yl 4-carbamoylbenzoate?
The InChIKey is DFCWTOFALXQNBP-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15NO3/c1-3-11(4-2)17-13(16)10-7-5-9(6-8-10)12(14)15/h3,5-8,11H,1,4H2,2H3,(H2,14,15).
What are the key properties of pent-1-en-3-yl 4-carbamoylbenzoate?
pent-1-en-3-yl 4-carbamoylbenzoate has a molecular weight of 233.27 g/mol, XLogP of 1.91, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for pent-1-en-3-yl 4-carbamoylbenzoate is sourced from PubChem (CID 86782375), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).