C14H12FN3O4 — CID 86789483
(2,6-dimethylpyrimidin-4-yl)methyl 4-fluoro-2-nitrobenzoate (PubChem CID 86789483) has the molecular formula C14H12FN3O4 and a molecular weight of 305.27 g/mol. Its IUPAC name is (2,6-dimethylpyrimidin-4-yl)methyl 4-fluoro-2-nitrobenzoate.
| Compound Name | (2,6-dimethylpyrimidin-4-yl)methyl 4-fluoro-2-nitrobenzoate |
|---|---|
| PubChem CID | 86789483 |
| Molecular Formula | C14H12FN3O4 |
| Molecular Weight | 305.27 g/mol |
| Exact Mass | 305.08 |
| IUPAC Name | (2,6-dimethylpyrimidin-4-yl)methyl 4-fluoro-2-nitrobenzoate |
| SMILES | Cc1cc(COC(=O)c2ccc(F)cc2[N+](=O)[O-])nc(C)n1 |
| InChI | InChI=1S/C14H12FN3O4/c1-8-5-11(17-9(2)16-8)7-22-14(19)12-4-3-10(15)6-13(12)18(20)21/h3-6H,7H2,1-2H3 |
| InChIKey | BMYUBKOPSDICEV-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 95.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.27 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|