C17H16F3NO3 — CID 86789930
2,4,5-trifluoro-3-hydroxy-N-(3-hydroxy-1-phenylpropyl)-N-methylbenzamide (PubChem CID 86789930) has the molecular formula C17H16F3NO3 and a molecular weight of 339.31 g/mol. Its IUPAC name is 2,4,5-trifluoro-3-hydroxy-N-(3-hydroxy-1-phenylpropyl)-N-methylbenzamide.
| Compound Name | 2,4,5-trifluoro-3-hydroxy-N-(3-hydroxy-1-phenylpropyl)-N-methylbenzamide |
|---|---|
| PubChem CID | 86789930 |
| Molecular Formula | C17H16F3NO3 |
| Molecular Weight | 339.31 g/mol |
| Exact Mass | 339.11 |
| IUPAC Name | 2,4,5-trifluoro-3-hydroxy-N-(3-hydroxy-1-phenylpropyl)-N-methylbenzamide |
| SMILES | CN(C(=O)c1cc(F)c(F)c(O)c1F)C(CCO)c1ccccc1 |
| InChI | InChI=1S/C17H16F3NO3/c1-21(13(7-8-22)10-5-3-2-4-6-10)17(24)11-9-12(18)15(20)16(23)14(11)19/h2-6,9,13,22-23H,7-8H2,1H3 |
| InChIKey | UMCYIWOFUQHSKC-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.31 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|