C24H35ClN2O4 — CID 86809998
2-[(2-chloroacetyl)-cyclopropylamino]-2-(3-methoxy-4-propan-2-yloxyphenyl)-N-(4-methylcyclohexyl)acetamide (PubChem CID 86809998) has the molecular formula C24H35ClN2O4 and a molecular weight of 451.01 g/mol. Its IUPAC name is 2-[(2-chloroacetyl)-cyclopropylamino]-2-(3-methoxy-4-propan-2-yloxyphenyl)-N-(4-methylcyclohexyl)acetamide.
| Compound Name | 2-[(2-chloroacetyl)-cyclopropylamino]-2-(3-methoxy-4-propan-2-yloxyphenyl)-N-(4-methylcyclohexyl)acetamide |
|---|---|
| PubChem CID | 86809998 |
| Molecular Formula | C24H35ClN2O4 |
| Molecular Weight | 451.01 g/mol |
| Exact Mass | 450.23 |
| IUPAC Name | 2-[(2-chloroacetyl)-cyclopropylamino]-2-(3-methoxy-4-propan-2-yloxyphenyl)-N-(4-methylcyclohexyl)acetamide |
| SMILES | COc1cc(C(C(=O)NC2CCC(C)CC2)N(C(=O)CCl)C2CC2)ccc1OC(C)C |
| InChI | InChI=1S/C24H35ClN2O4/c1-15(2)31-20-12-7-17(13-21(20)30-4)23(27(19-10-11-19)22(28)14-25)24(29)26-18-8-5-16(3)6-9-18/h7,12-13,15-16,18-19,23H,5-6,8-11,14H2,1-4H3,(H,26,29) |
| InChIKey | FMYJNERDXCSNJN-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.01 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|