About 5-bromo-N-[(2-methyl-1,3-thiazol-5-yl)methyl]-1H-indole-2-carboxamide
5-bromo-N-[(2-methyl-1,3-thiazol-5-yl)methyl]-1H-indole-2-carboxamide (PubChem CID 86836262) has the molecular formula C14H12BrN3OS
and a molecular weight of 350.24 g/mol. Its IUPAC name is 5-bromo-N-[(2-methyl-1,3-thiazol-5-yl)methyl]-1H-indole-2-carboxamide.
Molecular Properties
| Compound Name | 5-bromo-N-[(2-methyl-1,3-thiazol-5-yl)methyl]-1H-indole-2-carboxamide |
| PubChem CID | 86836262 |
| Molecular Formula | C14H12BrN3OS |
| Molecular Weight | 350.24 g/mol |
| Exact Mass | 348.99 |
| IUPAC Name | 5-bromo-N-[(2-methyl-1,3-thiazol-5-yl)methyl]-1H-indole-2-carboxamide |
| SMILES | Cc1ncc(CNC(=O)c2cc3cc(Br)ccc3[nH]2)s1 |
| InChI | InChI=1S/C14H12BrN3OS/c1-8-16-6-11(20-8)7-17-14(19)13-5-9-4-10(15)2-3-12(9)18-13/h2-6,18H,7H2,1H3,(H,17,19) |
| InChIKey | FSTIOLSVBRDWMP-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 350.24 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-bromo-N-[(2-methyl-1,3-thiazol-5-yl)methyl]-1H-indole-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-N-[(2-methyl-1,3-thiazol-5-yl)methyl]-1H-indole-2-carboxamide?
The IUPAC name of 5-bromo-N-[(2-methyl-1,3-thiazol-5-yl)methyl]-1H-indole-2-carboxamide (CID 86836262) is 5-bromo-N-[(2-methyl-1,3-thiazol-5-yl)methyl]-1H-indole-2-carboxamide.
What is the SMILES notation for 5-bromo-N-[(2-methyl-1,3-thiazol-5-yl)methyl]-1H-indole-2-carboxamide?
The canonical SMILES for 5-bromo-N-[(2-methyl-1,3-thiazol-5-yl)methyl]-1H-indole-2-carboxamide is Cc1ncc(CNC(=O)c2cc3cc(Br)ccc3[nH]2)s1.
What is the InChIKey of 5-bromo-N-[(2-methyl-1,3-thiazol-5-yl)methyl]-1H-indole-2-carboxamide?
The InChIKey is FSTIOLSVBRDWMP-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12BrN3OS/c1-8-16-6-11(20-8)7-17-14(19)13-5-9-4-10(15)2-3-12(9)18-13/h2-6,18H,7H2,1H3,(H,17,19).
What are the key properties of 5-bromo-N-[(2-methyl-1,3-thiazol-5-yl)methyl]-1H-indole-2-carboxamide?
5-bromo-N-[(2-methyl-1,3-thiazol-5-yl)methyl]-1H-indole-2-carboxamide has a molecular weight of 350.24 g/mol, XLogP of 3.63, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-N-[(2-methyl-1,3-thiazol-5-yl)methyl]-1H-indole-2-carboxamide is sourced from PubChem (CID 86836262), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).