C18H23N3OS2 — CID 86860524
N-(1-tert-butylpyrazol-4-yl)-4-(1,3-dithian-2-yl)benzamide (PubChem CID 86860524) has the molecular formula C18H23N3OS2 and a molecular weight of 361.54 g/mol. Its IUPAC name is N-(1-tert-butylpyrazol-4-yl)-4-(1,3-dithian-2-yl)benzamide.
| Compound Name | N-(1-tert-butylpyrazol-4-yl)-4-(1,3-dithian-2-yl)benzamide |
|---|---|
| PubChem CID | 86860524 |
| Molecular Formula | C18H23N3OS2 |
| Molecular Weight | 361.54 g/mol |
| Exact Mass | 361.13 |
| IUPAC Name | N-(1-tert-butylpyrazol-4-yl)-4-(1,3-dithian-2-yl)benzamide |
| SMILES | CC(C)(C)n1cc(NC(=O)c2ccc(C3SCCCS3)cc2)cn1 |
| InChI | InChI=1S/C18H23N3OS2/c1-18(2,3)21-12-15(11-19-21)20-16(22)13-5-7-14(8-6-13)17-23-9-4-10-24-17/h5-8,11-12,17H,4,9-10H2,1-3H3,(H,20,22) |
| InChIKey | JRMMRUSSXFUJPT-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.54 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |