C22H31N3O2S — CID 86875268
N-cyclohexyl-4-[[(E)-3-(4-methylsulfanylphenyl)prop-2-enoyl]amino]piperidine-1-carboxamide (PubChem CID 86875268) has the molecular formula C22H31N3O2S and a molecular weight of 401.58 g/mol. Its IUPAC name is N-cyclohexyl-4-[[(E)-3-(4-methylsulfanylphenyl)prop-2-enoyl]amino]piperidine-1-carboxamide.
| Compound Name | N-cyclohexyl-4-[[(E)-3-(4-methylsulfanylphenyl)prop-2-enoyl]amino]piperidine-1-carboxamide |
|---|---|
| PubChem CID | 86875268 |
| Molecular Formula | C22H31N3O2S |
| Molecular Weight | 401.58 g/mol |
| Exact Mass | 401.21 |
| IUPAC Name | N-cyclohexyl-4-[[(E)-3-(4-methylsulfanylphenyl)prop-2-enoyl]amino]piperidine-1-carboxamide |
| SMILES | CSc1ccc(/C=C/C(=O)NC2CCN(C(=O)NC3CCCCC3)CC2)cc1 |
| InChI | InChI=1S/C22H31N3O2S/c1-28-20-10-7-17(8-11-20)9-12-21(26)23-19-13-15-25(16-14-19)22(27)24-18-5-3-2-4-6-18/h7-12,18-19H,2-6,13-16H2,1H3,(H,23,26)(H,24,27)/b12-9+ |
| InChIKey | ACCYEWGXDSPHQC-FMIVXFBMSA-N |
| XLogP | 4.04 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.58 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|