C19H16N2OS — CID 868830
N-[4-(4-phenylphenyl)-1,3-thiazol-2-yl]cyclopropanecarboxamide (PubChem CID 868830) has the molecular formula C19H16N2OS and a molecular weight of 320.42 g/mol. Its IUPAC name is N-[4-(4-phenylphenyl)-1,3-thiazol-2-yl]cyclopropanecarboxamide.
| Compound Name | N-[4-(4-phenylphenyl)-1,3-thiazol-2-yl]cyclopropanecarboxamide |
|---|---|
| PubChem CID | 868830 |
| Molecular Formula | C19H16N2OS |
| Molecular Weight | 320.42 g/mol |
| Exact Mass | 320.10 |
| IUPAC Name | N-[4-(4-phenylphenyl)-1,3-thiazol-2-yl]cyclopropanecarboxamide |
| SMILES | O=C(Nc1nc(-c2ccc(-c3ccccc3)cc2)cs1)C1CC1 |
| InChI | InChI=1S/C19H16N2OS/c22-18(16-10-11-16)21-19-20-17(12-23-19)15-8-6-14(7-9-15)13-4-2-1-3-5-13/h1-9,12,16H,10-11H2,(H,20,21,22) |
| InChIKey | VWFVNWPQQLFHPN-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.42 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |