C20H23ClN4O2S — CID 86889686
1-[(6-chloroimidazo[1,2-a]pyridin-2-yl)methyl]-3-[1-[4-(2-methoxyethylsulfanyl)phenyl]ethyl]urea (PubChem CID 86889686) has the molecular formula C20H23ClN4O2S and a molecular weight of 418.95 g/mol. Its IUPAC name is 1-[(6-chloroimidazo[1,2-a]pyridin-2-yl)methyl]-3-[1-[4-(2-methoxyethylsulfanyl)phenyl]ethyl]urea.
| Compound Name | 1-[(6-chloroimidazo[1,2-a]pyridin-2-yl)methyl]-3-[1-[4-(2-methoxyethylsulfanyl)phenyl]ethyl]urea |
|---|---|
| PubChem CID | 86889686 |
| Molecular Formula | C20H23ClN4O2S |
| Molecular Weight | 418.95 g/mol |
| Exact Mass | 418.12 |
| IUPAC Name | 1-[(6-chloroimidazo[1,2-a]pyridin-2-yl)methyl]-3-[1-[4-(2-methoxyethylsulfanyl)phenyl]ethyl]urea |
| SMILES | COCCSc1ccc(C(C)NC(=O)NCc2cn3cc(Cl)ccc3n2)cc1 |
| InChI | InChI=1S/C20H23ClN4O2S/c1-14(15-3-6-18(7-4-15)28-10-9-27-2)23-20(26)22-11-17-13-25-12-16(21)5-8-19(25)24-17/h3-8,12-14H,9-11H2,1-2H3,(H2,22,23,26) |
| InChIKey | QZNZCIMLQQFXDD-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 67.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.95 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|