C14H13Cl2N3O3 — CID 86907899
N'-(3,5-dichloro-4-methoxybenzoyl)-1-methylpyrrole-2-carbohydrazide (PubChem CID 86907899) has the molecular formula C14H13Cl2N3O3 and a molecular weight of 342.18 g/mol. Its IUPAC name is N'-(3,5-dichloro-4-methoxybenzoyl)-1-methylpyrrole-2-carbohydrazide.
| Compound Name | N'-(3,5-dichloro-4-methoxybenzoyl)-1-methylpyrrole-2-carbohydrazide |
|---|---|
| PubChem CID | 86907899 |
| Molecular Formula | C14H13Cl2N3O3 |
| Molecular Weight | 342.18 g/mol |
| Exact Mass | 341.03 |
| IUPAC Name | N'-(3,5-dichloro-4-methoxybenzoyl)-1-methylpyrrole-2-carbohydrazide |
| SMILES | COc1c(Cl)cc(C(=O)NNC(=O)c2cccn2C)cc1Cl |
| InChI | InChI=1S/C14H13Cl2N3O3/c1-19-5-3-4-11(19)14(21)18-17-13(20)8-6-9(15)12(22-2)10(16)7-8/h3-7H,1-2H3,(H,17,20)(H,18,21) |
| InChIKey | QHYIFWXDACHNEO-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 72.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.18 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|