C17H27N4O4+ — CID 8692378
[2-(diethylamino)-2-oxoethyl]-[2-(4,5-dimethyl-2-nitroanilino)-2-oxoethyl]-methylazanium (PubChem CID 8692378) has the molecular formula C17H27N4O4+ and a molecular weight of 351.43 g/mol. Its IUPAC name is [2-(diethylamino)-2-oxoethyl]-[2-(4,5-dimethyl-2-nitroanilino)-2-oxoethyl]-methylazanium.
| Compound Name | [2-(diethylamino)-2-oxoethyl]-[2-(4,5-dimethyl-2-nitroanilino)-2-oxoethyl]-methylazanium |
|---|---|
| PubChem CID | 8692378 |
| Molecular Formula | C17H27N4O4+ |
| Molecular Weight | 351.43 g/mol |
| Exact Mass | 351.20 |
| IUPAC Name | [2-(diethylamino)-2-oxoethyl]-[2-(4,5-dimethyl-2-nitroanilino)-2-oxoethyl]-methylazanium |
| SMILES | CCN(CC)C(=O)C[NH+](C)CC(=O)Nc1cc(C)c(C)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C17H26N4O4/c1-6-20(7-2)17(23)11-19(5)10-16(22)18-14-8-12(3)13(4)9-15(14)21(24)25/h8-9H,6-7,10-11H2,1-5H3,(H,18,22)/p+1 |
| InChIKey | ZSHZOMSLMUAJOL-UHFFFAOYSA-O |
| XLogP | 0.53 |
| TPSA | 96.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.43 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|