C23H29N5O2 — CID 86933753
N-methyl-5-[(E)-3-[4-[2-(4-methylpiperazin-1-yl)ethyl]anilino]-3-oxoprop-1-enyl]pyridine-3-carboxamide (PubChem CID 86933753) has the molecular formula C23H29N5O2 and a molecular weight of 407.52 g/mol. Its IUPAC name is N-methyl-5-[(E)-3-[4-[2-(4-methylpiperazin-1-yl)ethyl]anilino]-3-oxoprop-1-enyl]pyridine-3-carboxamide.
| Compound Name | N-methyl-5-[(E)-3-[4-[2-(4-methylpiperazin-1-yl)ethyl]anilino]-3-oxoprop-1-enyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 86933753 |
| Molecular Formula | C23H29N5O2 |
| Molecular Weight | 407.52 g/mol |
| Exact Mass | 407.23 |
| IUPAC Name | N-methyl-5-[(E)-3-[4-[2-(4-methylpiperazin-1-yl)ethyl]anilino]-3-oxoprop-1-enyl]pyridine-3-carboxamide |
| SMILES | CNC(=O)c1cncc(/C=C/C(=O)Nc2ccc(CCN3CCN(C)CC3)cc2)c1 |
| InChI | InChI=1S/C23H29N5O2/c1-24-23(30)20-15-19(16-25-17-20)5-8-22(29)26-21-6-3-18(4-7-21)9-10-28-13-11-27(2)12-14-28/h3-8,15-17H,9-14H2,1-2H3,(H,24,30)(H,26,29)/b8-5+ |
| InChIKey | CIFVAELTDZBMNP-VMPITWQZSA-N |
| XLogP | 1.88 |
| TPSA | 77.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.52 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|