C20H15F3N2O4 — CID 86956358
[4-[(3-methyl-1,2,4-oxadiazol-5-yl)methoxy]phenyl] (E)-3-[3-(trifluoromethyl)phenyl]prop-2-enoate (PubChem CID 86956358) has the molecular formula C20H15F3N2O4 and a molecular weight of 404.34 g/mol. Its IUPAC name is [4-[(3-methyl-1,2,4-oxadiazol-5-yl)methoxy]phenyl] (E)-3-[3-(trifluoromethyl)phenyl]prop-2-enoate.
| Compound Name | [4-[(3-methyl-1,2,4-oxadiazol-5-yl)methoxy]phenyl] (E)-3-[3-(trifluoromethyl)phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 86956358 |
| Molecular Formula | C20H15F3N2O4 |
| Molecular Weight | 404.34 g/mol |
| Exact Mass | 404.10 |
| IUPAC Name | [4-[(3-methyl-1,2,4-oxadiazol-5-yl)methoxy]phenyl] (E)-3-[3-(trifluoromethyl)phenyl]prop-2-enoate |
| SMILES | Cc1noc(COc2ccc(OC(=O)/C=C/c3cccc(C(F)(F)F)c3)cc2)n1 |
| InChI | InChI=1S/C20H15F3N2O4/c1-13-24-18(29-25-13)12-27-16-6-8-17(9-7-16)28-19(26)10-5-14-3-2-4-15(11-14)20(21,22)23/h2-11H,12H2,1H3/b10-5+ |
| InChIKey | KWVSBDZHENXZTD-BJMVGYQFSA-N |
| XLogP | 4.59 |
| TPSA | 74.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.34 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|