C18H19BrClFN4O — CID 86961953
N-[3-(4-bromo-2-fluorophenyl)propyl]-5-chloro-2-pyrrolidin-1-ylpyrimidine-4-carboxamide (PubChem CID 86961953) has the molecular formula C18H19BrClFN4O and a molecular weight of 441.73 g/mol. Its IUPAC name is N-[3-(4-bromo-2-fluorophenyl)propyl]-5-chloro-2-pyrrolidin-1-ylpyrimidine-4-carboxamide.
| Compound Name | N-[3-(4-bromo-2-fluorophenyl)propyl]-5-chloro-2-pyrrolidin-1-ylpyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 86961953 |
| Molecular Formula | C18H19BrClFN4O |
| Molecular Weight | 441.73 g/mol |
| Exact Mass | 440.04 |
| IUPAC Name | N-[3-(4-bromo-2-fluorophenyl)propyl]-5-chloro-2-pyrrolidin-1-ylpyrimidine-4-carboxamide |
| SMILES | O=C(NCCCc1ccc(Br)cc1F)c1nc(N2CCCC2)ncc1Cl |
| InChI | InChI=1S/C18H19BrClFN4O/c19-13-6-5-12(15(21)10-13)4-3-7-22-17(26)16-14(20)11-23-18(24-16)25-8-1-2-9-25/h5-6,10-11H,1-4,7-9H2,(H,22,26) |
| InChIKey | JHSIMLDFKOTTSR-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.73 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|