C15H21FN2OS2 — CID 86999576
N-[3-(4-fluorophenyl)sulfanylpropyl]-1,4-thiazepane-4-carboxamide (PubChem CID 86999576) has the molecular formula C15H21FN2OS2 and a molecular weight of 328.48 g/mol. Its IUPAC name is N-[3-(4-fluorophenyl)sulfanylpropyl]-1,4-thiazepane-4-carboxamide.
| Compound Name | N-[3-(4-fluorophenyl)sulfanylpropyl]-1,4-thiazepane-4-carboxamide |
|---|---|
| PubChem CID | 86999576 |
| Molecular Formula | C15H21FN2OS2 |
| Molecular Weight | 328.48 g/mol |
| Exact Mass | 328.11 |
| IUPAC Name | N-[3-(4-fluorophenyl)sulfanylpropyl]-1,4-thiazepane-4-carboxamide |
| SMILES | O=C(NCCCSc1ccc(F)cc1)N1CCCSCC1 |
| InChI | InChI=1S/C15H21FN2OS2/c16-13-3-5-14(6-4-13)21-11-1-7-17-15(19)18-8-2-10-20-12-9-18/h3-6H,1-2,7-12H2,(H,17,19) |
| InChIKey | MWMHHLZHBSDYNG-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.48 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|