C18H20N2O2 — CID 87002397
N-benzyl-6-ethoxy-N-prop-2-enylpyridine-3-carboxamide (PubChem CID 87002397) has the molecular formula C18H20N2O2 and a molecular weight of 296.37 g/mol. Its IUPAC name is N-benzyl-6-ethoxy-N-prop-2-enylpyridine-3-carboxamide.
| Compound Name | N-benzyl-6-ethoxy-N-prop-2-enylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 87002397 |
| Molecular Formula | C18H20N2O2 |
| Molecular Weight | 296.37 g/mol |
| Exact Mass | 296.15 |
| IUPAC Name | N-benzyl-6-ethoxy-N-prop-2-enylpyridine-3-carboxamide |
| SMILES | C=CCN(Cc1ccccc1)C(=O)c1ccc(OCC)nc1 |
| InChI | InChI=1S/C18H20N2O2/c1-3-12-20(14-15-8-6-5-7-9-15)18(21)16-10-11-17(19-13-16)22-4-2/h3,5-11,13H,1,4,12,14H2,2H3 |
| InChIKey | BOIWKICMJKYFMZ-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.37 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|