C20H30N4O3 — CID 87008109
3-acetamido-N-[[3-(2-methylbutanoylamino)phenyl]methyl]piperidine-1-carboxamide (PubChem CID 87008109) has the molecular formula C20H30N4O3 and a molecular weight of 374.49 g/mol. Its IUPAC name is 3-acetamido-N-[[3-(2-methylbutanoylamino)phenyl]methyl]piperidine-1-carboxamide.
| Compound Name | 3-acetamido-N-[[3-(2-methylbutanoylamino)phenyl]methyl]piperidine-1-carboxamide |
|---|---|
| PubChem CID | 87008109 |
| Molecular Formula | C20H30N4O3 |
| Molecular Weight | 374.49 g/mol |
| Exact Mass | 374.23 |
| IUPAC Name | 3-acetamido-N-[[3-(2-methylbutanoylamino)phenyl]methyl]piperidine-1-carboxamide |
| SMILES | CCC(C)C(=O)Nc1cccc(CNC(=O)N2CCCC(NC(C)=O)C2)c1 |
| InChI | InChI=1S/C20H30N4O3/c1-4-14(2)19(26)23-17-8-5-7-16(11-17)12-21-20(27)24-10-6-9-18(13-24)22-15(3)25/h5,7-8,11,14,18H,4,6,9-10,12-13H2,1-3H3,(H,21,27)(H,22,25)(H,23,26) |
| InChIKey | RYROCUILDXDWPJ-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 90.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.49 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |