C13H20N4OS — CID 87037660
2-tert-butyl-5-[3-(1-methylpyrazol-4-yl)propylsulfanyl]-1,3,4-oxadiazole (PubChem CID 87037660) has the molecular formula C13H20N4OS and a molecular weight of 280.40 g/mol. Its IUPAC name is 2-tert-butyl-5-[3-(1-methylpyrazol-4-yl)propylsulfanyl]-1,3,4-oxadiazole.
| Compound Name | 2-tert-butyl-5-[3-(1-methylpyrazol-4-yl)propylsulfanyl]-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 87037660 |
| Molecular Formula | C13H20N4OS |
| Molecular Weight | 280.40 g/mol |
| Exact Mass | 280.14 |
| IUPAC Name | 2-tert-butyl-5-[3-(1-methylpyrazol-4-yl)propylsulfanyl]-1,3,4-oxadiazole |
| SMILES | Cn1cc(CCCSc2nnc(C(C)(C)C)o2)cn1 |
| InChI | InChI=1S/C13H20N4OS/c1-13(2,3)11-15-16-12(18-11)19-7-5-6-10-8-14-17(4)9-10/h8-9H,5-7H2,1-4H3 |
| InChIKey | YAKRRXWHYWOXBN-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 56.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.40 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|