C24H25ClN3O+ — CID 8704618
4-[[4-(2-chlorophenyl)piperazin-1-ium-1-yl]methyl]-N-phenylbenzamide (PubChem CID 8704618) has the molecular formula C24H25ClN3O+ and a molecular weight of 406.94 g/mol. Its IUPAC name is 4-[[4-(2-chlorophenyl)piperazin-1-ium-1-yl]methyl]-N-phenylbenzamide.
| Compound Name | 4-[[4-(2-chlorophenyl)piperazin-1-ium-1-yl]methyl]-N-phenylbenzamide |
|---|---|
| PubChem CID | 8704618 |
| Molecular Formula | C24H25ClN3O+ |
| Molecular Weight | 406.94 g/mol |
| Exact Mass | 406.17 |
| IUPAC Name | 4-[[4-(2-chlorophenyl)piperazin-1-ium-1-yl]methyl]-N-phenylbenzamide |
| SMILES | O=C(Nc1ccccc1)c1ccc(C[NH+]2CCN(c3ccccc3Cl)CC2)cc1 |
| InChI | InChI=1S/C24H24ClN3O/c25-22-8-4-5-9-23(22)28-16-14-27(15-17-28)18-19-10-12-20(13-11-19)24(29)26-21-6-2-1-3-7-21/h1-13H,14-18H2,(H,26,29)/p+1 |
| InChIKey | NTQDXUMPFBONOK-UHFFFAOYSA-O |
| XLogP | 3.50 |
| TPSA | 36.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.94 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |