C27H29N3O3 — CID 87047775
N-[(Z)-1-(5-methoxy-1H-indol-3-yl)-3-(1-methyl-6-azabicyclo[3.2.1]octan-6-yl)-3-oxoprop-1-en-2-yl]benzamide (PubChem CID 87047775) has the molecular formula C27H29N3O3 and a molecular weight of 443.55 g/mol. Its IUPAC name is N-[(Z)-1-(5-methoxy-1H-indol-3-yl)-3-(1-methyl-6-azabicyclo[3.2.1]octan-6-yl)-3-oxoprop-1-en-2-yl]benzamide.
| Compound Name | N-[(Z)-1-(5-methoxy-1H-indol-3-yl)-3-(1-methyl-6-azabicyclo[3.2.1]octan-6-yl)-3-oxoprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 87047775 |
| Molecular Formula | C27H29N3O3 |
| Molecular Weight | 443.55 g/mol |
| Exact Mass | 443.22 |
| IUPAC Name | N-[(Z)-1-(5-methoxy-1H-indol-3-yl)-3-(1-methyl-6-azabicyclo[3.2.1]octan-6-yl)-3-oxoprop-1-en-2-yl]benzamide |
| SMILES | COc1ccc2[nH]cc(/C=C(\NC(=O)c3ccccc3)C(=O)N3CC4(C)CCCC3C4)c2c1 |
| InChI | InChI=1S/C27H29N3O3/c1-27-12-6-9-20(15-27)30(17-27)26(32)24(29-25(31)18-7-4-3-5-8-18)13-19-16-28-23-11-10-21(33-2)14-22(19)23/h3-5,7-8,10-11,13-14,16,20,28H,6,9,12,15,17H2,1-2H3,(H,29,31)/b24-13- |
| InChIKey | HWQQEKKMLPQIAM-CFRMEGHHSA-N |
| XLogP | 4.74 |
| TPSA | 74.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.55 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|