C18H15N3O5S3 — CID 87070312
[2-(4-methyl-4,5-dihydro-1,3-thiazol-2-yl)-1,3-benzothiazol-6-yl] 4-methyl-2-nitrobenzenesulfonate (PubChem CID 87070312) has the molecular formula C18H15N3O5S3 and a molecular weight of 449.54 g/mol. Its IUPAC name is [2-(4-methyl-4,5-dihydro-1,3-thiazol-2-yl)-1,3-benzothiazol-6-yl] 4-methyl-2-nitrobenzenesulfonate.
| Compound Name | [2-(4-methyl-4,5-dihydro-1,3-thiazol-2-yl)-1,3-benzothiazol-6-yl] 4-methyl-2-nitrobenzenesulfonate |
|---|---|
| PubChem CID | 87070312 |
| Molecular Formula | C18H15N3O5S3 |
| Molecular Weight | 449.54 g/mol |
| Exact Mass | 449.02 |
| IUPAC Name | [2-(4-methyl-4,5-dihydro-1,3-thiazol-2-yl)-1,3-benzothiazol-6-yl] 4-methyl-2-nitrobenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)Oc2ccc3nc(C4=NC(C)CS4)sc3c2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C18H15N3O5S3/c1-10-3-6-16(14(7-10)21(22)23)29(24,25)26-12-4-5-13-15(8-12)28-18(20-13)17-19-11(2)9-27-17/h3-8,11H,9H2,1-2H3 |
| InChIKey | IFRPXPMOFDJUGO-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 111.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.54 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|